CAS:2424-92-2 | Eicosanedioic Acid
Molecular Formula:C20H38O4
Molecular Weight:342.5 g/mol
Purity:98%
Package:10g/25g/50g/100g/bulk package
Transportation: FeDex/DHL/Ocean shipping /Clients requirement
- Доставка по целия свят
- Осигуряване на качество
- 24/7 обслужване на клиенти
представяне на продукта
Applications
Eicosanedioic acid(CAS:2424-92-2) has been studied for its potential applications in various areas of scientific research. It has been used as an inhibitor of the enzyme ornithine decarboxylase, which is involved in the synthesis of polyamines. It has also been studied for its potential use as an inhibitor of the enzyme 5-alpha-reductase, which is involved in the synthesis of dihydrotestosterone. Additionally, it has been studied for its potential use as an inhibitor of the enzyme cyclooxygenase, which is involved in the synthesis of prostaglandins.
Specification
|
ITEMS |
SPECIFICATION |
| IUPAC Name | icosanedioic acid |
| MDL No | MFCD00059627 |
| Melting Point | 127ºC |
| Boiling Point | 504.1ºC at 760mmHg |
| Flash Point | 272.8ºC |
| Density | 0.984g/cm3 |
| PSA | 74.60 |
| LogP | 6.18 |
| Vapour Pressure | 1.57E-11mmHg at 25°C |
| Storage condition | Sealed in dry,Room Temperature |
| InChI | InChI=1S/C20H38O4/c21-19(22)17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20(23)24/h1-18H2,(H,21,22)(H,23,24) |
| InChI Key | JJOJFIHJIRWASH-UHFFFAOYSA-N |
Популярни тагове: cas:2424-92-2 | eicosanedioic acid, price, quotation, discount, in stock, for sale
