CAS:50548-43-1|4-Dibenzofuranamine
Molecular Formula:C12H9NO
Molecular Weight:183.21g/mol
Purity:98 percent
Package:5g/10g/25g/50g/bulk package
- Доставка по целия свят
- Осигуряване на качество
- 24/7 обслужване на клиенти
представяне на продукта
4-Dibenzofuranamine(CAS:50548-43-1) has been studied for its potential applications in drug delivery and as a corrosion inhibitor. It has also been studied for its potential therapeutic applications, including its ability to act as an anti-inflammatory agent. Additionally, 4-DBF has been studied for its potential use as a photodynamic therapy agent, as it has the ability to absorb light and convert it into energy.
|
|
|
| dibenzofuran-4-amine | |
| MFCD11110988 | |
| 369.1±15.0 degree at 760 mmHg | |
| 85 degree (lit.) | |
| 177.0±20.4 degree | |
| 1.3±0.1 g/cm3 | |
| 39.16 | |
| 2.84 | |
| {{0}}.0±0.8 mmHg at 25 degree | |
| 1.755 | |
| Keep in dark place,Inert atmosphere,2-8 degree | |
| InChI=1S/C12H9NO/c13-10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h1-7H,13H2 | |
| QKBTTXJHJNXCOQ-UHFFFAOYSA-N |
Популярни тагове: cas:50548-43-1|4-dibenzofuranamine, price, quotation, discount, in stock, for sale
